About (2R)-1-benzyl-2-[[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one
(2R)-1-benzyl-2-[[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one (PubChem CID 25180441) has the molecular formula C28H29NO3
and a molecular weight of 427.54 g/mol. Its IUPAC name is (2R)-1-benzyl-2-[[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one.
Molecular Properties
| Compound Name | (2R)-1-benzyl-2-[[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one |
| PubChem CID | 25180441 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | (2R)-1-benzyl-2-[[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one |
| SMILES | O=C1CCN(Cc2ccccc2)[C@H](C[C@H]2COC(c3ccccc3)(c3ccccc3)O2)C1 |
| InChI | InChI=1S/C28H29NO3/c30-26-16-17-29(20-22-10-4-1-5-11-22)25(18-26)19-27-21-31-28(32-27,23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-15,25,27H,16-21H2/t25-,27-/m0/s1 |
| InChIKey | CLXNYKWVICKXLM-BDYUSTAISA-N |
| XLogP | 4.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-1-benzyl-2-[[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-benzyl-2-[[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one?
The IUPAC name of (2R)-1-benzyl-2-[[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one (CID 25180441) is (2R)-1-benzyl-2-[[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one.
What is the SMILES notation for (2R)-1-benzyl-2-[[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one?
The canonical SMILES for (2R)-1-benzyl-2-[[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one is O=C1CCN(Cc2ccccc2)[C@H](C[C@H]2COC(c3ccccc3)(c3ccccc3)O2)C1.
What is the InChIKey of (2R)-1-benzyl-2-[[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one?
The InChIKey is CLXNYKWVICKXLM-BDYUSTAISA-N. The full InChI is InChI=1S/C28H29NO3/c30-26-16-17-29(20-22-10-4-1-5-11-22)25(18-26)19-27-21-31-28(32-27,23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-15,25,27H,16-21H2/t25-,27-/m0/s1.
What are the key properties of (2R)-1-benzyl-2-[[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one?
(2R)-1-benzyl-2-[[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one has a molecular weight of 427.54 g/mol, XLogP of 4.93, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-benzyl-2-[[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one is sourced from PubChem (CID 25180441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).