C21H23NO3 — CID 25178106
(2R)-2-[[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one (PubChem CID 25178106) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is (2R)-2-[[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one.
| Compound Name | (2R)-2-[[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one |
|---|---|
| PubChem CID | 25178106 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (2R)-2-[[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]methyl]piperidin-4-one |
| SMILES | O=C1CCN[C@H](C[C@@H]2COC(c3ccccc3)(c3ccccc3)O2)C1 |
| InChI | InChI=1S/C21H23NO3/c23-19-11-12-22-18(13-19)14-20-15-24-21(25-20,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,18,20,22H,11-15H2/t18-,20+/m0/s1 |
| InChIKey | FRQTZVABQYJSHQ-AZUAARDMSA-N |
| XLogP | 3.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |