About (4R)-4-[(1R)-1-fluoroprop-2-enyl]-2,2-diphenyl-1,3-dioxolane
(4R)-4-[(1R)-1-fluoroprop-2-enyl]-2,2-diphenyl-1,3-dioxolane (PubChem CID 139148658) has the molecular formula C36H34F2O4
and a molecular weight of 568.66 g/mol. Its IUPAC name is (4R)-4-[(1R)-1-fluoroprop-2-enyl]-2,2-diphenyl-1,3-dioxolane.
Molecular Properties
| Compound Name | (4R)-4-[(1R)-1-fluoroprop-2-enyl]-2,2-diphenyl-1,3-dioxolane |
| PubChem CID | 139148658 |
| Molecular Formula | C36H34F2O4 |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | (4R)-4-[(1R)-1-fluoroprop-2-enyl]-2,2-diphenyl-1,3-dioxolane |
| SMILES | C=C[C@@H](F)[C@H]1COC(c2ccccc2)(c2ccccc2)O1.C=C[C@@H](F)[C@H]1COC(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/2C18H17FO2/c2*1-2-16(19)17-13-20-18(21-17,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h2*2-12,16-17H,1,13H2/t2*16-,17-/m11/s1 |
| InChIKey | DZIHCBCHSCJGKR-OCUCFQOXSA-N |
| XLogP | 7.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-[(1R)-1-fluoroprop-2-enyl]-2,2-diphenyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-[(1R)-1-fluoroprop-2-enyl]-2,2-diphenyl-1,3-dioxolane?
The IUPAC name of (4R)-4-[(1R)-1-fluoroprop-2-enyl]-2,2-diphenyl-1,3-dioxolane (CID 139148658) is (4R)-4-[(1R)-1-fluoroprop-2-enyl]-2,2-diphenyl-1,3-dioxolane.
What is the SMILES notation for (4R)-4-[(1R)-1-fluoroprop-2-enyl]-2,2-diphenyl-1,3-dioxolane?
The canonical SMILES for (4R)-4-[(1R)-1-fluoroprop-2-enyl]-2,2-diphenyl-1,3-dioxolane is C=C[C@@H](F)[C@H]1COC(c2ccccc2)(c2ccccc2)O1.C=C[C@@H](F)[C@H]1COC(c2ccccc2)(c2ccccc2)O1.
What is the InChIKey of (4R)-4-[(1R)-1-fluoroprop-2-enyl]-2,2-diphenyl-1,3-dioxolane?
The InChIKey is DZIHCBCHSCJGKR-OCUCFQOXSA-N. The full InChI is InChI=1S/2C18H17FO2/c2*1-2-16(19)17-13-20-18(21-17,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h2*2-12,16-17H,1,13H2/t2*16-,17-/m11/s1.
What are the key properties of (4R)-4-[(1R)-1-fluoroprop-2-enyl]-2,2-diphenyl-1,3-dioxolane?
(4R)-4-[(1R)-1-fluoroprop-2-enyl]-2,2-diphenyl-1,3-dioxolane has a molecular weight of 568.66 g/mol, XLogP of 7.65, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-[(1R)-1-fluoroprop-2-enyl]-2,2-diphenyl-1,3-dioxolane is sourced from PubChem (CID 139148658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).