C11H17NO — CID 176925071
7-propan-2-yloxy-2,3,4,5-tetrahydro-1H-isoindole (PubChem CID 176925071) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 7-propan-2-yloxy-2,3,4,5-tetrahydro-1H-isoindole.
| Compound Name | 7-propan-2-yloxy-2,3,4,5-tetrahydro-1H-isoindole |
|---|---|
| PubChem CID | 176925071 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 7-propan-2-yloxy-2,3,4,5-tetrahydro-1H-isoindole |
| SMILES | CC(C)OC1=CCCC2=C1CNC2 |
| InChI | InChI=1S/C11H17NO/c1-8(2)13-11-5-3-4-9-6-12-7-10(9)11/h5,8,12H,3-4,6-7H2,1-2H3 |
| InChIKey | LWLTZXQKEFVQCQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |