C11H7ClN2OS — CID 176925914
5-chloro-6-(1,3-oxazol-2-yl)-1H-indole-2-thiol (PubChem CID 176925914) has the molecular formula C11H7ClN2OS and a molecular weight of 250.71 g/mol. Its IUPAC name is 5-chloro-6-(1,3-oxazol-2-yl)-1H-indole-2-thiol.
| Compound Name | 5-chloro-6-(1,3-oxazol-2-yl)-1H-indole-2-thiol |
|---|---|
| PubChem CID | 176925914 |
| Molecular Formula | C11H7ClN2OS |
| Molecular Weight | 250.71 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 5-chloro-6-(1,3-oxazol-2-yl)-1H-indole-2-thiol |
| SMILES | Sc1cc2cc(Cl)c(-c3ncco3)cc2[nH]1 |
| InChI | InChI=1S/C11H7ClN2OS/c12-8-3-6-4-10(16)14-9(6)5-7(8)11-13-1-2-15-11/h1-5,14,16H |
| InChIKey | XVIONRNEEIQGQI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.71 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|