C10H20S — CID 176926600
ethane;3-methyl-4-propan-2-yl-2,5-dihydrothiophene (PubChem CID 176926600) has the molecular formula C10H20S and a molecular weight of 172.34 g/mol. Its IUPAC name is ethane;3-methyl-4-propan-2-yl-2,5-dihydrothiophene.
| Compound Name | ethane;3-methyl-4-propan-2-yl-2,5-dihydrothiophene |
|---|---|
| PubChem CID | 176926600 |
| Molecular Formula | C10H20S |
| Molecular Weight | 172.34 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | ethane;3-methyl-4-propan-2-yl-2,5-dihydrothiophene |
| SMILES | CC.CC1=C(C(C)C)CSC1 |
| InChI | InChI=1S/C8H14S.C2H6/c1-6(2)8-5-9-4-7(8)3;1-2/h6H,4-5H2,1-3H3;1-2H3 |
| InChIKey | YJILCEZIXHHPHK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|