C12H24FNO2 — CID 176926700
ethane;[1-[(3-fluoro-4-methoxypyrrolidin-1-yl)methyl]cyclopropyl]methanol (PubChem CID 176926700) has the molecular formula C12H24FNO2 and a molecular weight of 233.33 g/mol. Its IUPAC name is ethane;[1-[(3-fluoro-4-methoxypyrrolidin-1-yl)methyl]cyclopropyl]methanol.
| Compound Name | ethane;[1-[(3-fluoro-4-methoxypyrrolidin-1-yl)methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 176926700 |
| Molecular Formula | C12H24FNO2 |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | ethane;[1-[(3-fluoro-4-methoxypyrrolidin-1-yl)methyl]cyclopropyl]methanol |
| SMILES | CC.COC1CN(CC2(CO)CC2)CC1F |
| InChI | InChI=1S/C10H18FNO2.C2H6/c1-14-9-5-12(4-8(9)11)6-10(7-13)2-3-10;1-2/h8-9,13H,2-7H2,1H3;1-2H3 |
| InChIKey | PRLJZNNTKJREAF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |