C18H30N4O2 — CID 176926876
ethane;(1R,14S)-7-methyl-9-propan-2-yl-4-oxa-8,10,12,17-tetrazatetracyclo[12.2.1.02,12.06,11]heptadeca-6,8,10-trien-5-one;molecular hydrogen (PubChem CID 176926876) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is ethane;(1R,14S)-7-methyl-9-propan-2-yl-4-oxa-8,10,12,17-tetrazatetracyclo[12.2.1.02,12.06,11]heptadeca-6,8,10-trien-5-one;molecular hydrogen.
| Compound Name | ethane;(1R,14S)-7-methyl-9-propan-2-yl-4-oxa-8,10,12,17-tetrazatetracyclo[12.2.1.02,12.06,11]heptadeca-6,8,10-trien-5-one;molecular hydrogen |
|---|---|
| PubChem CID | 176926876 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | ethane;(1R,14S)-7-methyl-9-propan-2-yl-4-oxa-8,10,12,17-tetrazatetracyclo[12.2.1.02,12.06,11]heptadeca-6,8,10-trien-5-one;molecular hydrogen |
| SMILES | CC.Cc1nc(C(C)C)nc2c1C(=O)OCC1[C@H]3CC[C@@H](CN21)N3.[H][H] |
| InChI | InChI=1S/C16H22N4O2.C2H6.H2/c1-8(2)14-17-9(3)13-15(19-14)20-6-10-4-5-11(18-10)12(20)7-22-16(13)21;1-2;/h8,10-12,18H,4-7H2,1-3H3;1-2H3;1H/t10-,11+,12?;;/m0../s1 |
| InChIKey | FKUFKPSALMJAOA-WXGLPHNMSA-N |
| XLogP | 2.66 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |