C20H44N2O — CID 176927912
2-ethyl-5-methylidenepiperidine;propan-2-ol;N,N,2,4-tetramethylpentan-1-amine (PubChem CID 176927912) has the molecular formula C20H44N2O and a molecular weight of 328.59 g/mol. Its IUPAC name is 2-ethyl-5-methylidenepiperidine;propan-2-ol;N,N,2,4-tetramethylpentan-1-amine.
| Compound Name | 2-ethyl-5-methylidenepiperidine;propan-2-ol;N,N,2,4-tetramethylpentan-1-amine |
|---|---|
| PubChem CID | 176927912 |
| Molecular Formula | C20H44N2O |
| Molecular Weight | 328.59 g/mol |
| Exact Mass | 328.35 |
| IUPAC Name | 2-ethyl-5-methylidenepiperidine;propan-2-ol;N,N,2,4-tetramethylpentan-1-amine |
| SMILES | C=C1CCC(CC)NC1.CC(C)CC(C)CN(C)C.CC(C)O |
| InChI | InChI=1S/C9H21N.C8H15N.C3H8O/c1-8(2)6-9(3)7-10(4)5;1-3-8-5-4-7(2)6-9-8;1-3(2)4/h8-9H,6-7H2,1-5H3;8-9H,2-6H2,1H3;3-4H,1-2H3 |
| InChIKey | DDSQFDPCBPLKOR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|