About 3-[7-[(1S)-1-(2,3-dihydroindol-1-yl)ethyl]naphthalen-2-yl]oxy-N,N-dimethylpropan-1-amine
3-[7-[(1S)-1-(2,3-dihydroindol-1-yl)ethyl]naphthalen-2-yl]oxy-N,N-dimethylpropan-1-amine (PubChem CID 176928161) has the molecular formula C25H30N2O
and a molecular weight of 374.53 g/mol. Its IUPAC name is 3-[7-[(1S)-1-(2,3-dihydroindol-1-yl)ethyl]naphthalen-2-yl]oxy-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[7-[(1S)-1-(2,3-dihydroindol-1-yl)ethyl]naphthalen-2-yl]oxy-N,N-dimethylpropan-1-amine |
| PubChem CID | 176928161 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 3-[7-[(1S)-1-(2,3-dihydroindol-1-yl)ethyl]naphthalen-2-yl]oxy-N,N-dimethylpropan-1-amine |
| SMILES | C[C@@H](c1ccc2ccc(OCCCN(C)C)cc2c1)N1CCc2ccccc21 |
| InChI | InChI=1S/C25H30N2O/c1-19(27-15-13-21-7-4-5-8-25(21)27)22-10-9-20-11-12-24(18-23(20)17-22)28-16-6-14-26(2)3/h4-5,7-12,17-19H,6,13-16H2,1-3H3/t19-/m0/s1 |
| InChIKey | PUVHMJDEJBNVRQ-IBGZPJMESA-N |
| XLogP | 5.29 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[7-[(1S)-1-(2,3-dihydroindol-1-yl)ethyl]naphthalen-2-yl]oxy-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[7-[(1S)-1-(2,3-dihydroindol-1-yl)ethyl]naphthalen-2-yl]oxy-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-[7-[(1S)-1-(2,3-dihydroindol-1-yl)ethyl]naphthalen-2-yl]oxy-N,N-dimethylpropan-1-amine (CID 176928161) is 3-[7-[(1S)-1-(2,3-dihydroindol-1-yl)ethyl]naphthalen-2-yl]oxy-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-[7-[(1S)-1-(2,3-dihydroindol-1-yl)ethyl]naphthalen-2-yl]oxy-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-[7-[(1S)-1-(2,3-dihydroindol-1-yl)ethyl]naphthalen-2-yl]oxy-N,N-dimethylpropan-1-amine is C[C@@H](c1ccc2ccc(OCCCN(C)C)cc2c1)N1CCc2ccccc21.
What is the InChIKey of 3-[7-[(1S)-1-(2,3-dihydroindol-1-yl)ethyl]naphthalen-2-yl]oxy-N,N-dimethylpropan-1-amine?
The InChIKey is PUVHMJDEJBNVRQ-IBGZPJMESA-N. The full InChI is InChI=1S/C25H30N2O/c1-19(27-15-13-21-7-4-5-8-25(21)27)22-10-9-20-11-12-24(18-23(20)17-22)28-16-6-14-26(2)3/h4-5,7-12,17-19H,6,13-16H2,1-3H3/t19-/m0/s1.
What are the key properties of 3-[7-[(1S)-1-(2,3-dihydroindol-1-yl)ethyl]naphthalen-2-yl]oxy-N,N-dimethylpropan-1-amine?
3-[7-[(1S)-1-(2,3-dihydroindol-1-yl)ethyl]naphthalen-2-yl]oxy-N,N-dimethylpropan-1-amine has a molecular weight of 374.53 g/mol, XLogP of 5.29, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[7-[(1S)-1-(2,3-dihydroindol-1-yl)ethyl]naphthalen-2-yl]oxy-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 176928161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).