C24H29N3O — CID 176928173
3-[3-[(1R)-1-(2,3-dihydroindol-1-yl)ethyl]quinolin-6-yl]oxy-N,N-dimethylpropan-1-amine (PubChem CID 176928173) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 3-[3-[(1R)-1-(2,3-dihydroindol-1-yl)ethyl]quinolin-6-yl]oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[3-[(1R)-1-(2,3-dihydroindol-1-yl)ethyl]quinolin-6-yl]oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 176928173 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 3-[3-[(1R)-1-(2,3-dihydroindol-1-yl)ethyl]quinolin-6-yl]oxy-N,N-dimethylpropan-1-amine |
| SMILES | C[C@H](c1cnc2ccc(OCCCN(C)C)cc2c1)N1CCc2ccccc21 |
| InChI | InChI=1S/C24H29N3O/c1-18(27-13-11-19-7-4-5-8-24(19)27)21-15-20-16-22(9-10-23(20)25-17-21)28-14-6-12-26(2)3/h4-5,7-10,15-18H,6,11-14H2,1-3H3/t18-/m1/s1 |
| InChIKey | KWGXKHVYGDODHJ-GOSISDBHSA-N |
| XLogP | 4.69 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|