About 3-ethyl-4-(2-methylprop-1-enyl)-2,5-dihydrofuran
3-ethyl-4-(2-methylprop-1-enyl)-2,5-dihydrofuran (PubChem CID 176929197) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is 3-ethyl-4-(2-methylprop-1-enyl)-2,5-dihydrofuran.
Analyze 3-ethyl-4-(2-methylprop-1-enyl)-2,5-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4-(2-methylprop-1-enyl)-2,5-dihydrofuran?
The IUPAC name of 3-ethyl-4-(2-methylprop-1-enyl)-2,5-dihydrofuran (CID 176929197) is 3-ethyl-4-(2-methylprop-1-enyl)-2,5-dihydrofuran.
What is the SMILES notation for 3-ethyl-4-(2-methylprop-1-enyl)-2,5-dihydrofuran?
The canonical SMILES for 3-ethyl-4-(2-methylprop-1-enyl)-2,5-dihydrofuran is CCC1=C(C=C(C)C)COC1.
What is the InChIKey of 3-ethyl-4-(2-methylprop-1-enyl)-2,5-dihydrofuran?
The InChIKey is ZEDUGYWYDZMKJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O/c1-4-9-6-11-7-10(9)5-8(2)3/h5H,4,6-7H2,1-3H3.
What are the key properties of 3-ethyl-4-(2-methylprop-1-enyl)-2,5-dihydrofuran?
3-ethyl-4-(2-methylprop-1-enyl)-2,5-dihydrofuran has a molecular weight of 152.24 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4-(2-methylprop-1-enyl)-2,5-dihydrofuran is sourced from PubChem (CID 176929197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).