C21H34F3NO — CID 176935007
4-butyl-1-[4-propan-2-yl-3-(trifluoromethoxy)phenyl]piperidine;ethane (PubChem CID 176935007) has the molecular formula C21H34F3NO and a molecular weight of 373.50 g/mol. Its IUPAC name is 4-butyl-1-[4-propan-2-yl-3-(trifluoromethoxy)phenyl]piperidine;ethane.
| Compound Name | 4-butyl-1-[4-propan-2-yl-3-(trifluoromethoxy)phenyl]piperidine;ethane |
|---|---|
| PubChem CID | 176935007 |
| Molecular Formula | C21H34F3NO |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 4-butyl-1-[4-propan-2-yl-3-(trifluoromethoxy)phenyl]piperidine;ethane |
| SMILES | CC.CCCCC1CCN(c2ccc(C(C)C)c(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H28F3NO.C2H6/c1-4-5-6-15-9-11-23(12-10-15)16-7-8-17(14(2)3)18(13-16)24-19(20,21)22;1-2/h7-8,13-15H,4-6,9-12H2,1-3H3;1-2H3 |
| InChIKey | FCMWMKLBKNMSJE-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |