C22H44N2 — CID 176936173
4-(cyclobutylmethyl)-1-propan-2-ylpiperidine;ethane;1-methyl-3-azabicyclo[4.1.0]heptane (PubChem CID 176936173) has the molecular formula C22H44N2 and a molecular weight of 336.61 g/mol. Its IUPAC name is 4-(cyclobutylmethyl)-1-propan-2-ylpiperidine;ethane;1-methyl-3-azabicyclo[4.1.0]heptane.
| Compound Name | 4-(cyclobutylmethyl)-1-propan-2-ylpiperidine;ethane;1-methyl-3-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 176936173 |
| Molecular Formula | C22H44N2 |
| Molecular Weight | 336.61 g/mol |
| Exact Mass | 336.35 |
| IUPAC Name | 4-(cyclobutylmethyl)-1-propan-2-ylpiperidine;ethane;1-methyl-3-azabicyclo[4.1.0]heptane |
| SMILES | CC.CC(C)N1CCC(CC2CCC2)CC1.CC12CNCCC1C2 |
| InChI | InChI=1S/C13H25N.C7H13N.C2H6/c1-11(2)14-8-6-13(7-9-14)10-12-4-3-5-12;1-7-4-6(7)2-3-8-5-7;1-2/h11-13H,3-10H2,1-2H3;6,8H,2-5H2,1H3;1-2H3 |
| InChIKey | BUHTVGWQEDYQMG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.61 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |