About 4-(cyclohexylmethyl)-1-propan-2-ylpiperidine;3-methylbutan-1-ol
4-(cyclohexylmethyl)-1-propan-2-ylpiperidine;3-methylbutan-1-ol (PubChem CID 170952399) has the molecular formula C20H41NO
and a molecular weight of 311.55 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-1-propan-2-ylpiperidine;3-methylbutan-1-ol.
Molecular Properties
| Compound Name | 4-(cyclohexylmethyl)-1-propan-2-ylpiperidine;3-methylbutan-1-ol |
| PubChem CID | 170952399 |
| Molecular Formula | C20H41NO |
| Molecular Weight | 311.55 g/mol |
| Exact Mass | 311.32 |
| IUPAC Name | 4-(cyclohexylmethyl)-1-propan-2-ylpiperidine;3-methylbutan-1-ol |
| SMILES | CC(C)CCO.CC(C)N1CCC(CC2CCCCC2)CC1 |
| InChI | InChI=1S/C15H29N.C5H12O/c1-13(2)16-10-8-15(9-11-16)12-14-6-4-3-5-7-14;1-5(2)3-4-6/h13-15H,3-12H2,1-2H3;5-6H,3-4H2,1-2H3 |
| InChIKey | DHXVVKLEICZTGS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(cyclohexylmethyl)-1-propan-2-ylpiperidine;3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclohexylmethyl)-1-propan-2-ylpiperidine;3-methylbutan-1-ol?
The IUPAC name of 4-(cyclohexylmethyl)-1-propan-2-ylpiperidine;3-methylbutan-1-ol (CID 170952399) is 4-(cyclohexylmethyl)-1-propan-2-ylpiperidine;3-methylbutan-1-ol.
What is the SMILES notation for 4-(cyclohexylmethyl)-1-propan-2-ylpiperidine;3-methylbutan-1-ol?
The canonical SMILES for 4-(cyclohexylmethyl)-1-propan-2-ylpiperidine;3-methylbutan-1-ol is CC(C)CCO.CC(C)N1CCC(CC2CCCCC2)CC1.
What is the InChIKey of 4-(cyclohexylmethyl)-1-propan-2-ylpiperidine;3-methylbutan-1-ol?
The InChIKey is DHXVVKLEICZTGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N.C5H12O/c1-13(2)16-10-8-15(9-11-16)12-14-6-4-3-5-7-14;1-5(2)3-4-6/h13-15H,3-12H2,1-2H3;5-6H,3-4H2,1-2H3.
What are the key properties of 4-(cyclohexylmethyl)-1-propan-2-ylpiperidine;3-methylbutan-1-ol?
4-(cyclohexylmethyl)-1-propan-2-ylpiperidine;3-methylbutan-1-ol has a molecular weight of 311.55 g/mol, XLogP of 5.10, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclohexylmethyl)-1-propan-2-ylpiperidine;3-methylbutan-1-ol is sourced from PubChem (CID 170952399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).