C55H99BO5S — CID 176937236
CID 176937236 (PubChem CID 176937236) has the molecular formula C55H99BO5S and a molecular weight of 883.27 g/mol.
| Compound Name | CID 176937236 |
|---|---|
| PubChem CID | 176937236 |
| Molecular Formula | C55H99BO5S |
| Molecular Weight | 883.27 g/mol |
| Exact Mass | 882.73 |
| IUPAC Name | — |
| SMILES | [B]CCCCCCOS(C)(C)OC(CC[C@@H](C)C1CCC2C3CCC4C[C@H](OC(=O)C(C)(C)C)CCC4(C)C3CCC21C)OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C55H99BO5S/c1-10-11-12-13-14-15-16-17-18-19-20-21-22-23-25-28-41-58-51(61-62(8,9)59-42-29-26-24-27-40-56)35-30-44(2)48-33-34-49-47-32-31-45-43-46(60-52(57)53(3,4)5)36-38-54(45,6)50(47)37-39-55(48,49)7/h14-15,17-18,44-51H,10-13,16,19-43H2,1-9H3/b15-14-,18-17-/t44-,45?,46-,47?,48?,49?,50?,51?,54?,55?/m1/s1 |
| InChIKey | YLEXUPBAFQRIFO-UXVCPSCESA-N |
| XLogP | 16.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.27 |
| LogP ≤ 5 | 16.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|