About [4-(propylamino)phenyl] thiohypochlorite
[4-(propylamino)phenyl] thiohypochlorite (PubChem CID 176938204) has the molecular formula C9H12ClNS
and a molecular weight of 201.72 g/mol. Its IUPAC name is [4-(propylamino)phenyl] thiohypochlorite.
Molecular Properties
| Compound Name | [4-(propylamino)phenyl] thiohypochlorite |
| PubChem CID | 176938204 |
| Molecular Formula | C9H12ClNS |
| Molecular Weight | 201.72 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | [4-(propylamino)phenyl] thiohypochlorite |
| SMILES | CCCNc1ccc(SCl)cc1 |
| InChI | InChI=1S/C9H12ClNS/c1-2-7-11-8-3-5-9(12-10)6-4-8/h3-6,11H,2,7H2,1H3 |
| InChIKey | WQWQAMKBVDMABV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.72 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-(propylamino)phenyl] thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(propylamino)phenyl] thiohypochlorite?
The IUPAC name of [4-(propylamino)phenyl] thiohypochlorite (CID 176938204) is [4-(propylamino)phenyl] thiohypochlorite.
What is the SMILES notation for [4-(propylamino)phenyl] thiohypochlorite?
The canonical SMILES for [4-(propylamino)phenyl] thiohypochlorite is CCCNc1ccc(SCl)cc1.
What is the InChIKey of [4-(propylamino)phenyl] thiohypochlorite?
The InChIKey is WQWQAMKBVDMABV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClNS/c1-2-7-11-8-3-5-9(12-10)6-4-8/h3-6,11H,2,7H2,1H3.
What are the key properties of [4-(propylamino)phenyl] thiohypochlorite?
[4-(propylamino)phenyl] thiohypochlorite has a molecular weight of 201.72 g/mol, XLogP of 3.75, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(propylamino)phenyl] thiohypochlorite is sourced from PubChem (CID 176938204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).