C29H32B5F2N3O3 — CID 176939627
CID 176939627 (PubChem CID 176939627) has the molecular formula C29H32B5F2N3O3 and a molecular weight of 562.65 g/mol.
| Compound Name | CID 176939627 |
|---|---|
| PubChem CID | 176939627 |
| Molecular Formula | C29H32B5F2N3O3 |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | — |
| SMILES | CC.[B]C([B])([B])Nc1cc(C(=O)O)ccc1C1CC2(CCN1C([B])([B])c1c(OC)cc(C)c3[nH]ccc13)CC(F)(F)C2 |
| InChI | InChI=1S/C27H26B5F2N3O3.C2H6/c1-14-9-20(40-2)21(17-5-7-35-22(14)17)26(28,29)37-8-6-24(12-25(33,34)13-24)11-19(37)16-4-3-15(23(38)39)10-18(16)36-27(30,31)32;1-2/h3-5,7,9-10,19,35-36H,6,8,11-13H2,1-2H3,(H,38,39);1-2H3 |
| InChIKey | OBCSHPOLGUDQJH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|