About CID 176939627
CID 176939627 (PubChem CID 176939627) has the molecular formula C29H32B5F2N3O3
and a molecular weight of 562.65 g/mol.
Molecular Properties
| Compound Name | CID 176939627 |
| PubChem CID | 176939627 |
| Molecular Formula | C29H32B5F2N3O3 |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | — |
| SMILES | CC.[B]C([B])([B])Nc1cc(C(=O)O)ccc1C1CC2(CCN1C([B])([B])c1c(OC)cc(C)c3[nH]ccc13)CC(F)(F)C2 |
| InChI | InChI=1S/C27H26B5F2N3O3.C2H6/c1-14-9-20(40-2)21(17-5-7-35-22(14)17)26(28,29)37-8-6-24(12-25(33,34)13-24)11-19(37)16-4-3-15(23(38)39)10-18(16)36-27(30,31)32;1-2/h3-5,7,9-10,19,35-36H,6,8,11-13H2,1-2H3,(H,38,39);1-2H3 |
| InChIKey | OBCSHPOLGUDQJH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 176939627 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176939627?
The IUPAC name of CID 176939627 (CID 176939627) is not available.
What is the SMILES notation for CID 176939627?
The canonical SMILES for CID 176939627 is CC.[B]C([B])([B])Nc1cc(C(=O)O)ccc1C1CC2(CCN1C([B])([B])c1c(OC)cc(C)c3[nH]ccc13)CC(F)(F)C2.
What is the InChIKey of CID 176939627?
The InChIKey is OBCSHPOLGUDQJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26B5F2N3O3.C2H6/c1-14-9-20(40-2)21(17-5-7-35-22(14)17)26(28,29)37-8-6-24(12-25(33,34)13-24)11-19(37)16-4-3-15(23(38)39)10-18(16)36-27(30,31)32;1-2/h3-5,7,9-10,19,35-36H,6,8,11-13H2,1-2H3,(H,38,39);1-2H3.
What are the key properties of CID 176939627?
CID 176939627 has a molecular weight of 562.65 g/mol, XLogP of 4.44, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176939627 is sourced from PubChem (CID 176939627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).