C28H36N4O3 — CID 176939939
ethane;methyl 3-(cyanomethylamino)-4-[1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoate (PubChem CID 176939939) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is ethane;methyl 3-(cyanomethylamino)-4-[1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoate.
| Compound Name | ethane;methyl 3-(cyanomethylamino)-4-[1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoate |
|---|---|
| PubChem CID | 176939939 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | ethane;methyl 3-(cyanomethylamino)-4-[1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoate |
| SMILES | CC.COC(=O)c1ccc(C2CCCCN2Cc2c(OC)cc(C)c3[nH]ccc23)c(NCC#N)c1 |
| InChI | InChI=1S/C26H30N4O3.C2H6/c1-17-14-24(32-2)21(19-9-11-29-25(17)19)16-30-13-5-4-6-23(30)20-8-7-18(26(31)33-3)15-22(20)28-12-10-27;1-2/h7-9,11,14-15,23,28-29H,4-6,12-13,16H2,1-3H3;1-2H3 |
| InChIKey | RQHLGYNTSWSTSD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|