C32H38N4O5 — CID 176943036
10-O-benzyl 7-O-tert-butyl 3-(4-cyclobutylphenyl)-13-oxa-2,3,7,10-tetrazatricyclo[6.5.1.04,14]tetradeca-1,4(14)-diene-7,10-dicarboxylate (PubChem CID 176943036) has the molecular formula C32H38N4O5 and a molecular weight of 558.68 g/mol. Its IUPAC name is 10-O-benzyl 7-O-tert-butyl 3-(4-cyclobutylphenyl)-13-oxa-2,3,7,10-tetrazatricyclo[6.5.1.04,14]tetradeca-1,4(14)-diene-7,10-dicarboxylate.
| Compound Name | 10-O-benzyl 7-O-tert-butyl 3-(4-cyclobutylphenyl)-13-oxa-2,3,7,10-tetrazatricyclo[6.5.1.04,14]tetradeca-1,4(14)-diene-7,10-dicarboxylate |
|---|---|
| PubChem CID | 176943036 |
| Molecular Formula | C32H38N4O5 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | 10-O-benzyl 7-O-tert-butyl 3-(4-cyclobutylphenyl)-13-oxa-2,3,7,10-tetrazatricyclo[6.5.1.04,14]tetradeca-1,4(14)-diene-7,10-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c3c(nn2-c2ccc(C4CCC4)cc2)OCCN(C(=O)OCc2ccccc2)CC31 |
| InChI | InChI=1S/C32H38N4O5/c1-32(2,3)41-31(38)35-17-16-26-28-27(35)20-34(30(37)40-21-22-8-5-4-6-9-22)18-19-39-29(28)33-36(26)25-14-12-24(13-15-25)23-10-7-11-23/h4-6,8-9,12-15,23,27H,7,10-11,16-21H2,1-3H3 |
| InChIKey | JYAYBXIEJAMXCB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 86.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |