About 2-(2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one;methoxyethane
2-(2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one;methoxyethane (PubChem CID 176943947) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is 2-(2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one;methoxyethane.
Molecular Properties
| Compound Name | 2-(2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one;methoxyethane |
| PubChem CID | 176943947 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 2-(2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one;methoxyethane |
| SMILES | CC1=C(C2CC2(C)C)C(=O)CC1.CCOC |
| InChI | InChI=1S/C11H16O.C3H8O/c1-7-4-5-9(12)10(7)8-6-11(8,2)3;1-3-4-2/h8H,4-6H2,1-3H3;3H2,1-2H3 |
| InChIKey | MLVLJLQTRVZLHD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one;methoxyethane?
The IUPAC name of 2-(2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one;methoxyethane (CID 176943947) is 2-(2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one;methoxyethane.
What is the SMILES notation for 2-(2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one;methoxyethane?
The canonical SMILES for 2-(2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one;methoxyethane is CC1=C(C2CC2(C)C)C(=O)CC1.CCOC.
What is the InChIKey of 2-(2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one;methoxyethane?
The InChIKey is MLVLJLQTRVZLHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O.C3H8O/c1-7-4-5-9(12)10(7)8-6-11(8,2)3;1-3-4-2/h8H,4-6H2,1-3H3;3H2,1-2H3.
What are the key properties of 2-(2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one;methoxyethane?
2-(2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one;methoxyethane has a molecular weight of 224.34 g/mol, XLogP of 3.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylcyclopropyl)-3-methylcyclopent-2-en-1-one;methoxyethane is sourced from PubChem (CID 176943947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).