C14H16N2O — CID 135004904
(7aR)-3,6,6-trimethyl-4-oxo-2,5,7,7a-tetrahydroindene-1,1-dicarbonitrile (PubChem CID 135004904) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is (7aR)-3,6,6-trimethyl-4-oxo-2,5,7,7a-tetrahydroindene-1,1-dicarbonitrile.
| Compound Name | (7aR)-3,6,6-trimethyl-4-oxo-2,5,7,7a-tetrahydroindene-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 135004904 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (7aR)-3,6,6-trimethyl-4-oxo-2,5,7,7a-tetrahydroindene-1,1-dicarbonitrile |
| SMILES | CC1=C2C(=O)CC(C)(C)C[C@@H]2C(C#N)(C#N)C1 |
| InChI | InChI=1S/C14H16N2O/c1-9-4-14(7-15,8-16)10-5-13(2,3)6-11(17)12(9)10/h10H,4-6H2,1-3H3/t10-/m0/s1 |
| InChIKey | MOLBOOBLFGOLSE-JTQLQIEISA-N |
| XLogP | 2.75 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |