C11H14N2O — CID 129321196
(2S)-2-ethyl-3-(hydroxymethyl)-4-methylcyclopent-3-ene-1,1-dicarbonitrile (PubChem CID 129321196) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is (2S)-2-ethyl-3-(hydroxymethyl)-4-methylcyclopent-3-ene-1,1-dicarbonitrile.
| Compound Name | (2S)-2-ethyl-3-(hydroxymethyl)-4-methylcyclopent-3-ene-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 129321196 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (2S)-2-ethyl-3-(hydroxymethyl)-4-methylcyclopent-3-ene-1,1-dicarbonitrile |
| SMILES | CC[C@@H]1C(CO)=C(C)CC1(C#N)C#N |
| InChI | InChI=1S/C11H14N2O/c1-3-10-9(5-14)8(2)4-11(10,6-12)7-13/h10,14H,3-5H2,1-2H3/t10-/m1/s1 |
| InChIKey | HHYINNHJWLXNLH-SNVBAGLBSA-N |
| XLogP | 1.76 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|