C9H17BN2O2 — CID 176945388
CID 176945388 (PubChem CID 176945388) has the molecular formula C9H17BN2O2 and a molecular weight of 196.06 g/mol.
| Compound Name | CID 176945388 |
|---|---|
| PubChem CID | 176945388 |
| Molecular Formula | C9H17BN2O2 |
| Molecular Weight | 196.06 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O.[B]c1ccn[nH]1 |
| InChI | InChI=1S/C6H14O2.C3H3BN2/c1-5(2,7)6(3,4)8;4-3-1-2-5-6-3/h7-8H,1-4H3;1-2H,(H,5,6) |
| InChIKey | ODUOTKQDJVFEIH-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.06 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|