C13H27NO3 — CID 176946500
2-[2-(6-ethyl-4,5-dimethyloxan-2-yl)oxyethoxy]ethanamine (PubChem CID 176946500) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is 2-[2-(6-ethyl-4,5-dimethyloxan-2-yl)oxyethoxy]ethanamine.
| Compound Name | 2-[2-(6-ethyl-4,5-dimethyloxan-2-yl)oxyethoxy]ethanamine |
|---|---|
| PubChem CID | 176946500 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | 2-[2-(6-ethyl-4,5-dimethyloxan-2-yl)oxyethoxy]ethanamine |
| SMILES | CCC1OC(OCCOCCN)CC(C)C1C |
| InChI | InChI=1S/C13H27NO3/c1-4-12-11(3)10(2)9-13(17-12)16-8-7-15-6-5-14/h10-13H,4-9,14H2,1-3H3 |
| InChIKey | ZOXVUWVJANJXQH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|