C23H24N2O5S2 — CID 176947363
[2-[(3-acetylphenyl)carbamoyl]thiophen-3-yl]-(4-ethoxy-N-methylanilino)methanesulfinic acid (PubChem CID 176947363) has the molecular formula C23H24N2O5S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is [2-[(3-acetylphenyl)carbamoyl]thiophen-3-yl]-(4-ethoxy-N-methylanilino)methanesulfinic acid.
| Compound Name | [2-[(3-acetylphenyl)carbamoyl]thiophen-3-yl]-(4-ethoxy-N-methylanilino)methanesulfinic acid |
|---|---|
| PubChem CID | 176947363 |
| Molecular Formula | C23H24N2O5S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | [2-[(3-acetylphenyl)carbamoyl]thiophen-3-yl]-(4-ethoxy-N-methylanilino)methanesulfinic acid |
| SMILES | CCOc1ccc(N(C)C(c2ccsc2C(=O)Nc2cccc(C(C)=O)c2)S(=O)O)cc1 |
| InChI | InChI=1S/C23H24N2O5S2/c1-4-30-19-10-8-18(9-11-19)25(3)23(32(28)29)20-12-13-31-21(20)22(27)24-17-7-5-6-16(14-17)15(2)26/h5-14,23H,4H2,1-3H3,(H,24,27)(H,28,29) |
| InChIKey | LTIOGZTYTGMRFY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|