C18H35NO3 — CID 176948728
N,2-diethyl-2-methyl-4-(3-methyl-6-oxooctan-3-yl)oxybutanamide (PubChem CID 176948728) has the molecular formula C18H35NO3 and a molecular weight of 313.48 g/mol. Its IUPAC name is N,2-diethyl-2-methyl-4-(3-methyl-6-oxooctan-3-yl)oxybutanamide.
| Compound Name | N,2-diethyl-2-methyl-4-(3-methyl-6-oxooctan-3-yl)oxybutanamide |
|---|---|
| PubChem CID | 176948728 |
| Molecular Formula | C18H35NO3 |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.26 |
| IUPAC Name | N,2-diethyl-2-methyl-4-(3-methyl-6-oxooctan-3-yl)oxybutanamide |
| SMILES | CCNC(=O)C(C)(CC)CCOC(C)(CC)CCC(=O)CC |
| InChI | InChI=1S/C18H35NO3/c1-7-15(20)11-12-18(6,9-3)22-14-13-17(5,8-2)16(21)19-10-4/h7-14H2,1-6H3,(H,19,21) |
| InChIKey | ANCOMLZONXYZKS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |