C21H43NO3 — CID 170703404
5-ethoxy-N-[3-methyl-3-(3,3,4-trimethylpentoxy)pentyl]pentanamide (PubChem CID 170703404) has the molecular formula C21H43NO3 and a molecular weight of 357.58 g/mol. Its IUPAC name is 5-ethoxy-N-[3-methyl-3-(3,3,4-trimethylpentoxy)pentyl]pentanamide.
| Compound Name | 5-ethoxy-N-[3-methyl-3-(3,3,4-trimethylpentoxy)pentyl]pentanamide |
|---|---|
| PubChem CID | 170703404 |
| Molecular Formula | C21H43NO3 |
| Molecular Weight | 357.58 g/mol |
| Exact Mass | 357.32 |
| IUPAC Name | 5-ethoxy-N-[3-methyl-3-(3,3,4-trimethylpentoxy)pentyl]pentanamide |
| SMILES | CCOCCCCC(=O)NCCC(C)(CC)OCCC(C)(C)C(C)C |
| InChI | InChI=1S/C21H43NO3/c1-8-21(7,25-17-14-20(5,6)18(3)4)13-15-22-19(23)12-10-11-16-24-9-2/h18H,8-17H2,1-7H3,(H,22,23) |
| InChIKey | RSZCHTLPTFEPSV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.58 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|