C16H33NO4 — CID 170278209
1-[4-[1-(methoxyamino)-3-methylpentan-3-yl]oxy-2-methylbutan-2-yl]oxybutan-2-one (PubChem CID 170278209) has the molecular formula C16H33NO4 and a molecular weight of 303.44 g/mol. Its IUPAC name is 1-[4-[1-(methoxyamino)-3-methylpentan-3-yl]oxy-2-methylbutan-2-yl]oxybutan-2-one.
| Compound Name | 1-[4-[1-(methoxyamino)-3-methylpentan-3-yl]oxy-2-methylbutan-2-yl]oxybutan-2-one |
|---|---|
| PubChem CID | 170278209 |
| Molecular Formula | C16H33NO4 |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | 1-[4-[1-(methoxyamino)-3-methylpentan-3-yl]oxy-2-methylbutan-2-yl]oxybutan-2-one |
| SMILES | CCC(=O)COC(C)(C)CCOC(C)(CC)CCNOC |
| InChI | InChI=1S/C16H33NO4/c1-7-14(18)13-21-15(3,4)10-12-20-16(5,8-2)9-11-17-19-6/h17H,7-13H2,1-6H3 |
| InChIKey | ZCBKYLQTQCLHCN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|