C18H37NO4 — CID 123506610
1-[3-methyl-1-[3-methyl-1-[2-(methylamino)ethoxy]pentan-3-yl]oxypentan-3-yl]oxypropan-2-one (PubChem CID 123506610) has the molecular formula C18H37NO4 and a molecular weight of 331.50 g/mol. Its IUPAC name is 1-[3-methyl-1-[3-methyl-1-[2-(methylamino)ethoxy]pentan-3-yl]oxypentan-3-yl]oxypropan-2-one.
| Compound Name | 1-[3-methyl-1-[3-methyl-1-[2-(methylamino)ethoxy]pentan-3-yl]oxypentan-3-yl]oxypropan-2-one |
|---|---|
| PubChem CID | 123506610 |
| Molecular Formula | C18H37NO4 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | 1-[3-methyl-1-[3-methyl-1-[2-(methylamino)ethoxy]pentan-3-yl]oxypentan-3-yl]oxypropan-2-one |
| SMILES | CCC(C)(CCOCCNC)OCCC(C)(CC)OCC(C)=O |
| InChI | InChI=1S/C18H37NO4/c1-7-17(4,9-12-21-14-11-19-6)22-13-10-18(5,8-2)23-15-16(3)20/h19H,7-15H2,1-6H3 |
| InChIKey | LDDUIZDPTDJVKC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|