C23H29FN2O7 — CID 176950568
N-[4-(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-2,6-bis(trihydroxymethyl)phenyl]-3,3-dimethylbutanamide (PubChem CID 176950568) has the molecular formula C23H29FN2O7 and a molecular weight of 464.49 g/mol. Its IUPAC name is N-[4-(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-2,6-bis(trihydroxymethyl)phenyl]-3,3-dimethylbutanamide.
| Compound Name | N-[4-(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-2,6-bis(trihydroxymethyl)phenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 176950568 |
| Molecular Formula | C23H29FN2O7 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-[4-(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-2,6-bis(trihydroxymethyl)phenyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)Nc1c(C(O)(O)O)cc(N2CCc3cc(F)ccc3C2)cc1C(O)(O)O |
| InChI | InChI=1S/C23H29FN2O7/c1-21(2,3)11-19(27)25-20-17(22(28,29)30)9-16(10-18(20)23(31,32)33)26-7-6-13-8-15(24)5-4-14(13)12-26/h4-5,8-10,28-33H,6-7,11-12H2,1-3H3,(H,25,27) |
| InChIKey | HKDMQHCKTHOXOZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 153.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|