C24H30F2N2O — CID 167440599
N-[4-(7,8-difluoro-1,3,4,5-tetrahydro-2-benzazepin-2-yl)-2,6-dimethylphenyl]-3,3-dimethylbutanamide (PubChem CID 167440599) has the molecular formula C24H30F2N2O and a molecular weight of 400.51 g/mol. Its IUPAC name is N-[4-(7,8-difluoro-1,3,4,5-tetrahydro-2-benzazepin-2-yl)-2,6-dimethylphenyl]-3,3-dimethylbutanamide.
| Compound Name | N-[4-(7,8-difluoro-1,3,4,5-tetrahydro-2-benzazepin-2-yl)-2,6-dimethylphenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 167440599 |
| Molecular Formula | C24H30F2N2O |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | N-[4-(7,8-difluoro-1,3,4,5-tetrahydro-2-benzazepin-2-yl)-2,6-dimethylphenyl]-3,3-dimethylbutanamide |
| SMILES | Cc1cc(N2CCCc3cc(F)c(F)cc3C2)cc(C)c1NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C24H30F2N2O/c1-15-9-19(10-16(2)23(15)27-22(29)13-24(3,4)5)28-8-6-7-17-11-20(25)21(26)12-18(17)14-28/h9-12H,6-8,13-14H2,1-5H3,(H,27,29) |
| InChIKey | JOAMRMLVFNSVEN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |