C28H40N2O2 — CID 167440554
N-[4-(7-butan-2-yloxy-1,3,4,5-tetrahydro-2-benzazepin-2-yl)-2,6-dimethylphenyl]-3,3-dimethylbutanamide (PubChem CID 167440554) has the molecular formula C28H40N2O2 and a molecular weight of 436.64 g/mol. Its IUPAC name is N-[4-(7-butan-2-yloxy-1,3,4,5-tetrahydro-2-benzazepin-2-yl)-2,6-dimethylphenyl]-3,3-dimethylbutanamide.
| Compound Name | N-[4-(7-butan-2-yloxy-1,3,4,5-tetrahydro-2-benzazepin-2-yl)-2,6-dimethylphenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 167440554 |
| Molecular Formula | C28H40N2O2 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.31 |
| IUPAC Name | N-[4-(7-butan-2-yloxy-1,3,4,5-tetrahydro-2-benzazepin-2-yl)-2,6-dimethylphenyl]-3,3-dimethylbutanamide |
| SMILES | CCC(C)Oc1ccc2c(c1)CCCN(c1cc(C)c(NC(=O)CC(C)(C)C)c(C)c1)C2 |
| InChI | InChI=1S/C28H40N2O2/c1-8-21(4)32-25-12-11-23-18-30(13-9-10-22(23)16-25)24-14-19(2)27(20(3)15-24)29-26(31)17-28(5,6)7/h11-12,14-16,21H,8-10,13,17-18H2,1-7H3,(H,29,31) |
| InChIKey | SALCHZBSDXTALA-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |