C22H30N2OS — CID 147255048
N-[2,6-dimethyl-4-(4,6,7,8-tetrahydrothieno[3,2-c]azepin-5-yl)phenyl]-3,3-dimethylbutanamide (PubChem CID 147255048) has the molecular formula C22H30N2OS and a molecular weight of 370.56 g/mol. Its IUPAC name is N-[2,6-dimethyl-4-(4,6,7,8-tetrahydrothieno[3,2-c]azepin-5-yl)phenyl]-3,3-dimethylbutanamide.
| Compound Name | N-[2,6-dimethyl-4-(4,6,7,8-tetrahydrothieno[3,2-c]azepin-5-yl)phenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 147255048 |
| Molecular Formula | C22H30N2OS |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | N-[2,6-dimethyl-4-(4,6,7,8-tetrahydrothieno[3,2-c]azepin-5-yl)phenyl]-3,3-dimethylbutanamide |
| SMILES | Cc1cc(N2CCCc3sccc3C2)cc(C)c1NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C22H30N2OS/c1-15-11-18(24-9-6-7-19-17(14-24)8-10-26-19)12-16(2)21(15)23-20(25)13-22(3,4)5/h8,10-12H,6-7,9,13-14H2,1-5H3,(H,23,25) |
| InChIKey | CNLACPVGKHRRPP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |