C22H29FN2OS — CID 147695605
N-[4-(2-fluoro-4,6,7,8-tetrahydrothieno[3,2-c]azepin-5-yl)-2,6-dimethylphenyl]-3,3-dimethylbutanamide (PubChem CID 147695605) has the molecular formula C22H29FN2OS and a molecular weight of 388.55 g/mol. Its IUPAC name is N-[4-(2-fluoro-4,6,7,8-tetrahydrothieno[3,2-c]azepin-5-yl)-2,6-dimethylphenyl]-3,3-dimethylbutanamide.
| Compound Name | N-[4-(2-fluoro-4,6,7,8-tetrahydrothieno[3,2-c]azepin-5-yl)-2,6-dimethylphenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 147695605 |
| Molecular Formula | C22H29FN2OS |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-[4-(2-fluoro-4,6,7,8-tetrahydrothieno[3,2-c]azepin-5-yl)-2,6-dimethylphenyl]-3,3-dimethylbutanamide |
| SMILES | Cc1cc(N2CCCc3sc(F)cc3C2)cc(C)c1NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C22H29FN2OS/c1-14-9-17(10-15(2)21(14)24-20(26)12-22(3,4)5)25-8-6-7-18-16(13-25)11-19(23)27-18/h9-11H,6-8,12-13H2,1-5H3,(H,24,26) |
| InChIKey | GRVLUMHKKKRWEZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |