C16H21ClF2N4O — CID 176950902
7-chloro-8-fluoro-4-(2-fluoro-3-methylazepan-1-yl)-1H-pyrido[4,3-d]pyrimidin-2-one;ethane (PubChem CID 176950902) has the molecular formula C16H21ClF2N4O and a molecular weight of 358.82 g/mol. Its IUPAC name is 7-chloro-8-fluoro-4-(2-fluoro-3-methylazepan-1-yl)-1H-pyrido[4,3-d]pyrimidin-2-one;ethane.
| Compound Name | 7-chloro-8-fluoro-4-(2-fluoro-3-methylazepan-1-yl)-1H-pyrido[4,3-d]pyrimidin-2-one;ethane |
|---|---|
| PubChem CID | 176950902 |
| Molecular Formula | C16H21ClF2N4O |
| Molecular Weight | 358.82 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 7-chloro-8-fluoro-4-(2-fluoro-3-methylazepan-1-yl)-1H-pyrido[4,3-d]pyrimidin-2-one;ethane |
| SMILES | CC.CC1CCCCN(c2nc(=O)[nH]c3c(F)c(Cl)ncc23)C1F |
| InChI | InChI=1S/C14H15ClF2N4O.C2H6/c1-7-4-2-3-5-21(12(7)17)13-8-6-18-11(15)9(16)10(8)19-14(22)20-13;1-2/h6-7,12H,2-5H2,1H3,(H,19,20,22);1-2H3 |
| InChIKey | NMRBJMNFCHUTSC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.82 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|