C13H11ClF2N4O2 — CID 176951052
7-chloro-8-fluoro-4-[(8S)-8-fluoro-5-oxa-2-azabicyclo[5.1.0]octan-2-yl]-1H-pyrido[4,3-d]pyrimidin-2-one (PubChem CID 176951052) has the molecular formula C13H11ClF2N4O2 and a molecular weight of 328.71 g/mol. Its IUPAC name is 7-chloro-8-fluoro-4-[(8S)-8-fluoro-5-oxa-2-azabicyclo[5.1.0]octan-2-yl]-1H-pyrido[4,3-d]pyrimidin-2-one.
| Compound Name | 7-chloro-8-fluoro-4-[(8S)-8-fluoro-5-oxa-2-azabicyclo[5.1.0]octan-2-yl]-1H-pyrido[4,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 176951052 |
| Molecular Formula | C13H11ClF2N4O2 |
| Molecular Weight | 328.71 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 7-chloro-8-fluoro-4-[(8S)-8-fluoro-5-oxa-2-azabicyclo[5.1.0]octan-2-yl]-1H-pyrido[4,3-d]pyrimidin-2-one |
| SMILES | O=c1nc(N2CCOCC3C2[C@H]3F)c2cnc(Cl)c(F)c2[nH]1 |
| InChI | InChI=1S/C13H11ClF2N4O2/c14-11-8(16)9-5(3-17-11)12(19-13(21)18-9)20-1-2-22-4-6-7(15)10(6)20/h3,6-7,10H,1-2,4H2,(H,18,19,21)/t6?,7-,10?/m0/s1 |
| InChIKey | RVFYYLXLLYJEGE-DSQUFTABSA-N |
| XLogP | 1.28 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.71 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|