C13H12ClFN4O4 — CID 176950829
7-chloro-4-(5,5-dihydroxy-2-oxa-6-azabicyclo[5.1.0]octan-6-yl)-8-fluoro-1H-pyrido[4,3-d]pyrimidin-2-one (PubChem CID 176950829) has the molecular formula C13H12ClFN4O4 and a molecular weight of 342.71 g/mol. Its IUPAC name is 7-chloro-4-(5,5-dihydroxy-2-oxa-6-azabicyclo[5.1.0]octan-6-yl)-8-fluoro-1H-pyrido[4,3-d]pyrimidin-2-one.
| Compound Name | 7-chloro-4-(5,5-dihydroxy-2-oxa-6-azabicyclo[5.1.0]octan-6-yl)-8-fluoro-1H-pyrido[4,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 176950829 |
| Molecular Formula | C13H12ClFN4O4 |
| Molecular Weight | 342.71 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 7-chloro-4-(5,5-dihydroxy-2-oxa-6-azabicyclo[5.1.0]octan-6-yl)-8-fluoro-1H-pyrido[4,3-d]pyrimidin-2-one |
| SMILES | O=c1nc(N2C3CC3OCCC2(O)O)c2cnc(Cl)c(F)c2[nH]1 |
| InChI | InChI=1S/C13H12ClFN4O4/c14-10-8(15)9-5(4-16-10)11(18-12(20)17-9)19-6-3-7(6)23-2-1-13(19,21)22/h4,6-7,21-22H,1-3H2,(H,17,18,20) |
| InChIKey | KARXHKOMYZLSMB-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.71 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|