C13H15Cl2FN4O2 — CID 178016902
4-(2,7-dichloro-8-fluoro-1-methyl-2H-pyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepan-6-ol (PubChem CID 178016902) has the molecular formula C13H15Cl2FN4O2 and a molecular weight of 349.19 g/mol. Its IUPAC name is 4-(2,7-dichloro-8-fluoro-1-methyl-2H-pyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepan-6-ol.
| Compound Name | 4-(2,7-dichloro-8-fluoro-1-methyl-2H-pyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 178016902 |
| Molecular Formula | C13H15Cl2FN4O2 |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 4-(2,7-dichloro-8-fluoro-1-methyl-2H-pyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepan-6-ol |
| SMILES | CN1c2c(cnc(Cl)c2F)C(N2CCOCC(O)C2)=NC1Cl |
| InChI | InChI=1S/C13H15Cl2FN4O2/c1-19-10-8(4-17-11(14)9(10)16)12(18-13(19)15)20-2-3-22-6-7(21)5-20/h4,7,13,21H,2-3,5-6H2,1H3 |
| InChIKey | ZGIZZKULKFOGCW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 61.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|