C13H13Cl2FN4O2 — CID 176594142
4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-6-methoxy-1,4-oxazepane (PubChem CID 176594142) has the molecular formula C13H13Cl2FN4O2 and a molecular weight of 347.18 g/mol. Its IUPAC name is 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-6-methoxy-1,4-oxazepane.
| Compound Name | 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-6-methoxy-1,4-oxazepane |
|---|---|
| PubChem CID | 176594142 |
| Molecular Formula | C13H13Cl2FN4O2 |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-6-methoxy-1,4-oxazepane |
| SMILES | COC1COCCN(c2nc(Cl)nc3c(F)c(Cl)ncc23)C1 |
| InChI | InChI=1S/C13H13Cl2FN4O2/c1-21-7-5-20(2-3-22-6-7)12-8-4-17-11(14)9(16)10(8)18-13(15)19-12/h4,7H,2-3,5-6H2,1H3 |
| InChIKey | JXJAVULAXLCHKD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|