C14H16ClFN4O3 — CID 164535056
4-(7-chloro-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl)-6-methyl-1,4-oxazepan-6-ol (PubChem CID 164535056) has the molecular formula C14H16ClFN4O3 and a molecular weight of 342.76 g/mol. Its IUPAC name is 4-(7-chloro-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl)-6-methyl-1,4-oxazepan-6-ol.
| Compound Name | 4-(7-chloro-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl)-6-methyl-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 164535056 |
| Molecular Formula | C14H16ClFN4O3 |
| Molecular Weight | 342.76 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 4-(7-chloro-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl)-6-methyl-1,4-oxazepan-6-ol |
| SMILES | COc1nc(N2CCOCC(C)(O)C2)c2cnc(Cl)c(F)c2n1 |
| InChI | InChI=1S/C14H16ClFN4O3/c1-14(21)6-20(3-4-23-7-14)12-8-5-17-11(15)9(16)10(8)18-13(19-12)22-2/h5,21H,3-4,6-7H2,1-2H3 |
| InChIKey | QGHDMRRELLXWFL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 80.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.76 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|