C13H11Cl2FN4O2 — CID 176951213
7-chloro-4-[(1R,7S,8R)-8-chloro-2-oxa-6-azabicyclo[5.1.0]octan-6-yl]-8-fluoro-1H-pyrido[4,3-d]pyrimidin-2-one (PubChem CID 176951213) has the molecular formula C13H11Cl2FN4O2 and a molecular weight of 345.16 g/mol. Its IUPAC name is 7-chloro-4-[(1R,7S,8R)-8-chloro-2-oxa-6-azabicyclo[5.1.0]octan-6-yl]-8-fluoro-1H-pyrido[4,3-d]pyrimidin-2-one.
| Compound Name | 7-chloro-4-[(1R,7S,8R)-8-chloro-2-oxa-6-azabicyclo[5.1.0]octan-6-yl]-8-fluoro-1H-pyrido[4,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 176951213 |
| Molecular Formula | C13H11Cl2FN4O2 |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 7-chloro-4-[(1R,7S,8R)-8-chloro-2-oxa-6-azabicyclo[5.1.0]octan-6-yl]-8-fluoro-1H-pyrido[4,3-d]pyrimidin-2-one |
| SMILES | O=c1nc(N2CCCO[C@H]3[C@H](Cl)[C@H]32)c2cnc(Cl)c(F)c2[nH]1 |
| InChI | InChI=1S/C13H11Cl2FN4O2/c14-6-9-10(6)22-3-1-2-20(9)12-5-4-17-11(15)7(16)8(5)18-13(21)19-12/h4,6,9-10H,1-3H2,(H,18,19,21)/t6-,9-,10+/m1/s1 |
| InChIKey | MFSAGOKZDKGQOP-DRTBCBBWSA-N |
| XLogP | 1.70 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|