C13H10Cl3FN4O — CID 176776741
(1R,8R)-8-chloro-6-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2-oxa-6-azabicyclo[5.1.0]octane (PubChem CID 176776741) has the molecular formula C13H10Cl3FN4O and a molecular weight of 363.61 g/mol. Its IUPAC name is (1R,8R)-8-chloro-6-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2-oxa-6-azabicyclo[5.1.0]octane.
| Compound Name | (1R,8R)-8-chloro-6-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2-oxa-6-azabicyclo[5.1.0]octane |
|---|---|
| PubChem CID | 176776741 |
| Molecular Formula | C13H10Cl3FN4O |
| Molecular Weight | 363.61 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | (1R,8R)-8-chloro-6-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2-oxa-6-azabicyclo[5.1.0]octane |
| SMILES | Fc1c(Cl)ncc2c(N3CCCO[C@@H]4C3[C@H]4Cl)nc(Cl)nc12 |
| InChI | InChI=1S/C13H10Cl3FN4O/c14-6-9-10(6)22-3-1-2-21(9)12-5-4-18-11(15)7(17)8(5)19-13(16)20-12/h4,6,9-10H,1-3H2/t6-,9?,10+/m1/s1 |
| InChIKey | IYUYGINUSFRUBQ-UEYWXQRQSA-N |
| XLogP | 3.06 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.61 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|