C13H11ClF2N4O — CID 176951340
7-chloro-8-fluoro-4-[(1S,6R,7S)-7-fluoro-2-azabicyclo[4.1.0]heptan-2-yl]-1H-pyrido[4,3-d]pyrimidin-2-one (PubChem CID 176951340) has the molecular formula C13H11ClF2N4O and a molecular weight of 312.71 g/mol. Its IUPAC name is 7-chloro-8-fluoro-4-[(1S,6R,7S)-7-fluoro-2-azabicyclo[4.1.0]heptan-2-yl]-1H-pyrido[4,3-d]pyrimidin-2-one.
| Compound Name | 7-chloro-8-fluoro-4-[(1S,6R,7S)-7-fluoro-2-azabicyclo[4.1.0]heptan-2-yl]-1H-pyrido[4,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 176951340 |
| Molecular Formula | C13H11ClF2N4O |
| Molecular Weight | 312.71 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 7-chloro-8-fluoro-4-[(1S,6R,7S)-7-fluoro-2-azabicyclo[4.1.0]heptan-2-yl]-1H-pyrido[4,3-d]pyrimidin-2-one |
| SMILES | O=c1nc(N2CCC[C@H]3[C@H](F)[C@H]32)c2cnc(Cl)c(F)c2[nH]1 |
| InChI | InChI=1S/C13H11ClF2N4O/c14-11-8(16)9-6(4-17-11)12(19-13(21)18-9)20-3-1-2-5-7(15)10(5)20/h4-5,7,10H,1-3H2,(H,18,19,21)/t5-,7-,10-/m0/s1 |
| InChIKey | UOYBPFAPBZJVQG-AYKAFODUSA-N |
| XLogP | 2.05 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.71 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|