C13H12ClFN4O — CID 176951423
4-(2-azabicyclo[4.1.0]heptan-2-yl)-7-chloro-8-fluoro-1H-pyrido[4,3-d]pyrimidin-2-one (PubChem CID 176951423) has the molecular formula C13H12ClFN4O and a molecular weight of 294.72 g/mol. Its IUPAC name is 4-(2-azabicyclo[4.1.0]heptan-2-yl)-7-chloro-8-fluoro-1H-pyrido[4,3-d]pyrimidin-2-one.
| Compound Name | 4-(2-azabicyclo[4.1.0]heptan-2-yl)-7-chloro-8-fluoro-1H-pyrido[4,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 176951423 |
| Molecular Formula | C13H12ClFN4O |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 4-(2-azabicyclo[4.1.0]heptan-2-yl)-7-chloro-8-fluoro-1H-pyrido[4,3-d]pyrimidin-2-one |
| SMILES | O=c1nc(N2CCCC3CC32)c2cnc(Cl)c(F)c2[nH]1 |
| InChI | InChI=1S/C13H12ClFN4O/c14-11-9(15)10-7(5-16-11)12(18-13(20)17-10)19-3-1-2-6-4-8(6)19/h5-6,8H,1-4H2,(H,17,18,20) |
| InChIKey | RYSRWMSTHVECDC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|