C14H24F3N3O3 — CID 176953564
ethane;2-ethyloxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 176953564) has the molecular formula C14H24F3N3O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is ethane;2-ethyloxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | ethane;2-ethyloxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 176953564 |
| Molecular Formula | C14H24F3N3O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | ethane;2-ethyloxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CC.CCC1OCCC(O)C1O.Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C7H14O3.C5H4F3N3.C2H6/c1-2-6-7(9)5(8)3-4-10-6;6-5(7,8)3-1-10-2-4(9)11-3;1-2/h5-9H,2-4H2,1H3;1-2H,(H2,9,11);1-2H3 |
| InChIKey | UBXSRROCKUBKFH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |