C30H53N5O5 — CID 176954439
N-[1-(butan-2-ylamino)propan-2-yl]-N-ethanimidoyl-6-[3-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]propanoyl]-6-azaspiro[3.5]nonane-2-carboximidamide (PubChem CID 176954439) has the molecular formula C30H53N5O5 and a molecular weight of 563.78 g/mol. Its IUPAC name is N-[1-(butan-2-ylamino)propan-2-yl]-N-ethanimidoyl-6-[3-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]propanoyl]-6-azaspiro[3.5]nonane-2-carboximidamide.
| Compound Name | N-[1-(butan-2-ylamino)propan-2-yl]-N-ethanimidoyl-6-[3-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]propanoyl]-6-azaspiro[3.5]nonane-2-carboximidamide |
|---|---|
| PubChem CID | 176954439 |
| Molecular Formula | C30H53N5O5 |
| Molecular Weight | 563.78 g/mol |
| Exact Mass | 563.40 |
| IUPAC Name | N-[1-(butan-2-ylamino)propan-2-yl]-N-ethanimidoyl-6-[3-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]propanoyl]-6-azaspiro[3.5]nonane-2-carboximidamide |
| SMILES | [H]/N=C(/C1CC2(CCCN(C(=O)CCOCCOCCOCCOCC#C)C2)C1)N(/C(C)=N/[H])C(C)CNC(C)CC |
| InChI | InChI=1S/C30H53N5O5/c1-6-12-37-14-16-39-18-19-40-17-15-38-13-9-28(36)34-11-8-10-30(23-34)20-27(21-30)29(32)35(26(5)31)25(4)22-33-24(3)7-2/h1,24-25,27,31-33H,7-23H2,2-5H3/b31-26+,32-29- |
| InChIKey | XDXKMIXFUDGKNG-ZNOHXIPUSA-N |
| XLogP | 3.15 |
| TPSA | 120.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.78 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|