C18H19ClN2O2 — CID 176958000
methyl 5-[[(1Z,3Z)-3-chlorohexa-1,3-dienyl]-methylamino]quinoline-2-carboxylate (PubChem CID 176958000) has the molecular formula C18H19ClN2O2 and a molecular weight of 330.82 g/mol. Its IUPAC name is methyl 5-[[(1Z,3Z)-3-chlorohexa-1,3-dienyl]-methylamino]quinoline-2-carboxylate.
| Compound Name | methyl 5-[[(1Z,3Z)-3-chlorohexa-1,3-dienyl]-methylamino]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 176958000 |
| Molecular Formula | C18H19ClN2O2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | methyl 5-[[(1Z,3Z)-3-chlorohexa-1,3-dienyl]-methylamino]quinoline-2-carboxylate |
| SMILES | CC/C=C(Cl)/C=C\N(C)c1cccc2nc(C(=O)OC)ccc12 |
| InChI | InChI=1S/C18H19ClN2O2/c1-4-6-13(19)11-12-21(2)17-8-5-7-15-14(17)9-10-16(20-15)18(22)23-3/h5-12H,4H2,1-3H3/b12-11-,13-6- |
| InChIKey | FIWVVUCWDFFKJU-OJRGXSJSSA-N |
| XLogP | 4.50 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|