C18H20N2O2 — CID 176957909
5-[methyl-[(1Z,3E)-3-methylhexa-1,3-dienyl]amino]quinoline-2-carboxylic acid (PubChem CID 176957909) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 5-[methyl-[(1Z,3E)-3-methylhexa-1,3-dienyl]amino]quinoline-2-carboxylic acid.
| Compound Name | 5-[methyl-[(1Z,3E)-3-methylhexa-1,3-dienyl]amino]quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 176957909 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 5-[methyl-[(1Z,3E)-3-methylhexa-1,3-dienyl]amino]quinoline-2-carboxylic acid |
| SMILES | CC/C=C(C)/C=C\N(C)c1cccc2nc(C(=O)O)ccc12 |
| InChI | InChI=1S/C18H20N2O2/c1-4-6-13(2)11-12-20(3)17-8-5-7-15-14(17)9-10-16(19-15)18(21)22/h5-12H,4H2,1-3H3,(H,21,22)/b12-11-,13-6+ |
| InChIKey | HYOGOAASWYIRRO-CNZPJCCLSA-N |
| XLogP | 4.24 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|