C18H19N3O4 — CID 176957921
5-[methyl-[(1E,3E)-3-methyl-2-nitrohexa-1,3-dienyl]amino]quinoline-2-carboxylic acid (PubChem CID 176957921) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 5-[methyl-[(1E,3E)-3-methyl-2-nitrohexa-1,3-dienyl]amino]quinoline-2-carboxylic acid.
| Compound Name | 5-[methyl-[(1E,3E)-3-methyl-2-nitrohexa-1,3-dienyl]amino]quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 176957921 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 5-[methyl-[(1E,3E)-3-methyl-2-nitrohexa-1,3-dienyl]amino]quinoline-2-carboxylic acid |
| SMILES | CC/C=C(C)/C(=C\N(C)c1cccc2nc(C(=O)O)ccc12)[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N3O4/c1-4-6-12(2)17(21(24)25)11-20(3)16-8-5-7-14-13(16)9-10-15(19-14)18(22)23/h5-11H,4H2,1-3H3,(H,22,23)/b12-6+,17-11+ |
| InChIKey | RGASHYGVLOTLBT-IRWMSUPXSA-N |
| XLogP | 3.84 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|